Products 2168973-67-7
CAS 2168973-67-7 is the registry number for 2-(5-(Trifluoromethyl)oxazol-4-yl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[5-(trifluoromethyl)-1,3-oxazol-4-yl]acetic acid (CAS 2168973-67-7) is a chemical compound with the molecular formula C6H4F3NO3 and a molecular weight of 195.10 g/mol. IUPAC name: 2-[5-(trifluoromethyl)-1,3-oxazol-4-yl]acetic acid. InChIKey: CZYCYDILLJJBEZ-UHFFFAOYSA-N.
| Molecular formula | C6H4F3NO3 |
|---|---|
| Molecular weight | 195.10 g/mol |
| IUPAC name | 2-[5-(trifluoromethyl)-1,3-oxazol-4-yl]acetic acid |
| InChIKey | CZYCYDILLJJBEZ-UHFFFAOYSA-N |
| SMILES | C1=NC(=C(O1)C(F)(F)F)CC(=O)O |
Computed by PubChem (NCBI)