Products 1368958-26-2
CAS 1368958-26-2 appears in our catalog under these names: 2-(4-Chlorobenzyl)oxazole-4-carboxylic acid, 95%, 2-(4-Chlorobenzyl)oxazole-4-carboxylic Acid, >95%, >95%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg, 5g.
2-[(4-chlorophenyl)methyl]-1,3-oxazole-4-carboxylic acid (CAS 1368958-26-2) is a chemical compound with the molecular formula C11H8ClNO3 and a molecular weight of 237.64 g/mol. IUPAC name: 2-[(4-chlorophenyl)methyl]-1,3-oxazole-4-carboxylic acid. InChIKey: LOVCYJHOVDEDCM-UHFFFAOYSA-N.
| Molecular formula | C11H8ClNO3 |
|---|---|
| Molecular weight | 237.64 g/mol |
| IUPAC name | 2-[(4-chlorophenyl)methyl]-1,3-oxazole-4-carboxylic acid |
| InChIKey | LOVCYJHOVDEDCM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC2=NC(=CO2)C(=O)O)Cl |
Computed by PubChem (NCBI)