Products 1369477-55-3

CAS 1369477-55-3 is the registry number for 2-Chloro-4-methoxycinnamic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

(E)-3-(2-chloro-4-methoxyphenyl)prop-2-enoic acid (CAS 1369477-55-3) is a chemical compound with the molecular formula C10H9ClO3 and a molecular weight of 212.63 g/mol. IUPAC name: (E)-3-(2-chloro-4-methoxyphenyl)prop-2-enoic acid. InChIKey: PMKYTVZKTJDIJK-HWKANZROSA-N.

Identity
Molecular formulaC10H9ClO3
Molecular weight212.63 g/mol
IUPAC name(E)-3-(2-chloro-4-methoxyphenyl)prop-2-enoic acid
InChIKeyPMKYTVZKTJDIJK-HWKANZROSA-N
SMILESCOC1=CC(=C(C=C1)/C=C/C(=O)O)Cl

Computed by PubChem (NCBI)