CAS 137240-10-9 appears in our catalog under these names: 4,5–Dichlorothieno(2,3–d)pyrimidine, 4,5-Dichlorothieno[2,3-d]pyrimidine, 95%, 95%, 4,5-Dichlorothieno[2,3-d]pyrimidine, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
4,5-dichlorothieno[2,3-d]pyrimidine (CAS 137240-10-9) is a chemical compound with the molecular formula C6H2Cl2N2S and a molecular weight of 205.06 g/mol. IUPAC name: 4,5-dichlorothieno[2,3-d]pyrimidine. InChIKey: DGELLYDZWYBYEP-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2N2S |
|---|---|
| Molecular weight | 205.06 g/mol |
| IUPAC name | 4,5-dichlorothieno[2,3-d]pyrimidine |
| InChIKey | DGELLYDZWYBYEP-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(S1)N=CN=C2Cl)Cl |
Computed by PubChem (NCBI)