CAS 1124383-04-5 appears in our catalog under these names: 5,7–Dichloro–(1,2,4)triazolo(1,5–a)pyridin–2–amine, 5,7-Dichloro-[1,2,4]triazolo[1,5-a]pyridin-2-amine 97%. Offered by: GLPBio, Ambeed. Available pack sizes: 1g, 250mg, 100mg, 5g.
5,7-dichloro-[1,2,4]triazolo[1,5-a]pyridin-2-amine (CAS 1124383-04-5) is a chemical compound with the molecular formula C6H4Cl2N4 and a molecular weight of 203.03 g/mol. IUPAC name: 5,7-dichloro-[1,2,4]triazolo[1,5-a]pyridin-2-amine. InChIKey: LBSAWUJERBIKBF-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl2N4 |
|---|---|
| Molecular weight | 203.03 g/mol |
| IUPAC name | 5,7-dichloro-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| InChIKey | LBSAWUJERBIKBF-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(N2C1=NC(=N2)N)Cl)Cl |
Computed by PubChem (NCBI)