CAS 1374357-85-3 is the registry number for 6-Bromo-3-methylisochroman-1-one, 95%. Offered by: AmBeed. Available pack sizes: 1g.
6-bromo-3-methyl-3,4-dihydroisochromen-1-one (CAS 1374357-85-3) is a chemical compound with the molecular formula C10H9BrO2 and a molecular weight of 241.08 g/mol. IUPAC name: 6-bromo-3-methyl-3,4-dihydroisochromen-1-one. InChIKey: FQXNEJZEPHQHEK-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO2 |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | 6-bromo-3-methyl-3,4-dihydroisochromen-1-one |
| InChIKey | FQXNEJZEPHQHEK-UHFFFAOYSA-N |
| SMILES | CC1CC2=C(C=CC(=C2)Br)C(=O)O1 |
Computed by PubChem (NCBI)