Products 137490-86-9
CAS 137490-86-9 is the registry number for (S)-Methyl 2-amino-3-(thiophen-2-yl)propanoate hydrochloride, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g.
Methyl (2S)-2-amino-3-thiophen-2-ylpropanoate;hydrochloride (CAS 137490-86-9) is a chemical compound with the molecular formula C8H12ClNO2S and a molecular weight of 221.71 g/mol. IUPAC name: methyl (2S)-2-amino-3-thiophen-2-ylpropanoate;hydrochloride. InChIKey: JOTSVOSIVDVLQL-FJXQXJEOSA-N.
| Molecular formula | C8H12ClNO2S |
|---|---|
| Molecular weight | 221.71 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-thiophen-2-ylpropanoate;hydrochloride |
| InChIKey | JOTSVOSIVDVLQL-FJXQXJEOSA-N |
| SMILES | COC(=O)[C@H](CC1=CC=CS1)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
(S)-Methyl 2-amino-3-(thiophen-2-yl)propanoate hydrochloride, (S)-Methyl 2-amino-3-(thiophen-2-yl)propanoate HCl, JOTSVOSIVDVLQL-FJXQXJEOSA-N, beta-(2-thienyl)-L-alanine methyl ester hydrochloride, methyl (2S)-2-amino-3-(2-thienyl)propanoate;hydrochloride, methyl (2S)-2-amino-3-thiophen-2-ylpropanoate;hydrochloride