Products 1375068-95-3
CAS 1375068-95-3 appears in our catalog under these names: 3-(5-Methoxypyridin-3-yl)benzoic acid, 98%, 3-(5-Methoxypyridin-3-yl)benzoic acid, 98%, 98%. Offered by: Combi-blocks, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 100mg.
3-(5-methoxy-3-pyridinyl)benzoic acid (CAS 1375068-95-3) is a chemical compound with the molecular formula C13H11NO3 and a molecular weight of 229.23 g/mol. IUPAC name: 3-(5-methoxy-3-pyridinyl)benzoic acid. InChIKey: YPWKEGOCVGNLJE-UHFFFAOYSA-N.
| Molecular formula | C13H11NO3 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | 3-(5-methoxy-3-pyridinyl)benzoic acid |
| InChIKey | YPWKEGOCVGNLJE-UHFFFAOYSA-N |
| SMILES | COC1=CN=CC(=C1)C2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)