CAS 137540-94-4 is the registry number for 2-(2-Chloroethyl)-2H,3H-(1,2,4)triazolo(4,3-a)pyridin-3-one. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
2-(2-chloroethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-one (CAS 137540-94-4) is a chemical compound with the molecular formula C8H8ClN3O and a molecular weight of 197.62 g/mol. IUPAC name: 2-(2-chloroethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-one. InChIKey: TYQKZFOAABYLAF-UHFFFAOYSA-N.
| Molecular formula | C8H8ClN3O |
|---|---|
| Molecular weight | 197.62 g/mol |
| IUPAC name | 2-(2-chloroethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-one |
| InChIKey | TYQKZFOAABYLAF-UHFFFAOYSA-N |
| SMILES | C1=CC2=NN(C(=O)N2C=C1)CCCl |
Computed by PubChem (NCBI)