Products 1375913-88-4
CAS 1375913-88-4 is the registry number for Methyl 4-(1H-pyrrole-3-carbonyl)benzoate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Methyl 4-(1H-pyrrole-3-carbonyl)benzoate (CAS 1375913-88-4) is a chemical compound with the molecular formula C13H11NO3 and a molecular weight of 229.23 g/mol. IUPAC name: methyl 4-(1H-pyrrole-3-carbonyl)benzoate. InChIKey: NIIZVGHWZPYCCG-UHFFFAOYSA-N.
| Molecular formula | C13H11NO3 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | methyl 4-(1H-pyrrole-3-carbonyl)benzoate |
| InChIKey | NIIZVGHWZPYCCG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C(=O)C2=CNC=C2 |
Computed by PubChem (NCBI)