CAS 137612-85-2 appears in our catalog under these names: 2–Chloro–6–methoxyquinoline–3–carboxylic acid, 2-Chloro-6-methoxyquinoline-3-carboxylic acid. Offered by: GLPBio, Biosynth. Available pack sizes: 100mg, 1g, 250mg.
2-chloro-6-methoxyquinoline-3-carboxylic acid (CAS 137612-85-2) is a chemical compound with the molecular formula C11H8ClNO3 and a molecular weight of 237.64 g/mol. IUPAC name: 2-chloro-6-methoxyquinoline-3-carboxylic acid. InChIKey: ZPOJSCBYMLQIEL-UHFFFAOYSA-N.
| Molecular formula | C11H8ClNO3 |
|---|---|
| Molecular weight | 237.64 g/mol |
| IUPAC name | 2-chloro-6-methoxyquinoline-3-carboxylic acid |
| InChIKey | ZPOJSCBYMLQIEL-UHFFFAOYSA-N |
| SMILES | COC1=CC2=CC(=C(N=C2C=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)