Products 1396174-10-9
CAS 1396174-10-9 is the registry number for 8-Fluoro-3,4-dihydrodibenzo(b,d)furan-1(2H)-one, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
8-fluoro-3,4-dihydro-2H-dibenzofuran-1-one (CAS 1396174-10-9) is a chemical compound with the molecular formula C12H9FO2 and a molecular weight of 204.20 g/mol. IUPAC name: 8-fluoro-3,4-dihydro-2H-dibenzofuran-1-one. InChIKey: ZLQDXJXIBJYONW-UHFFFAOYSA-N.
| Molecular formula | C12H9FO2 |
|---|---|
| Molecular weight | 204.20 g/mol |
| IUPAC name | 8-fluoro-3,4-dihydro-2H-dibenzofuran-1-one |
| InChIKey | ZLQDXJXIBJYONW-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=O)C1)C3=C(O2)C=CC(=C3)F |
Computed by PubChem (NCBI)