Products 13772-63-9
CAS 13772-63-9 appears in our catalog under these names: Methyl 3–nitro–1–naphthoate, Methyl 3-nitro-1-naphthoate 95%, Methyl 3-nitro-1-naphthoate, 95%, 95%, Methyl 3-nitro-1-naphthoate, ≥95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
Methyl 3-nitronaphthalene-1-carboxylate (CAS 13772-63-9) is a chemical compound with the molecular formula C12H9NO4 and a molecular weight of 231.20 g/mol. IUPAC name: methyl 3-nitronaphthalene-1-carboxylate. InChIKey: QFUDSCNJHFVWIB-UHFFFAOYSA-N.
| Molecular formula | C12H9NO4 |
|---|---|
| Molecular weight | 231.20 g/mol |
| IUPAC name | methyl 3-nitronaphthalene-1-carboxylate |
| InChIKey | QFUDSCNJHFVWIB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC2=CC=CC=C21)[N+](=O)[O-] |
Computed by PubChem (NCBI)