CAS 2093128-28-8 appears in our catalog under these names: (±)-Pomolidomide-d3 (phthalimide-4,5,6-d3), 99 atom % D, min 98% Chemical Purity, Pomalidomide-d3, 99.0%. Offered by: CDN, MedChemExpress. Available pack sizes: 0,01g, 0,005g, 1 mg.
4-amino-5,6,7-trideuterio-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (CAS 2093128-28-8) is a chemical compound with the molecular formula C13H11N3O4 and a molecular weight of 276.26 g/mol. IUPAC name: 4-amino-5,6,7-trideuterio-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione. InChIKey: UVSMNLNDYGZFPF-CBYSEHNBSA-N.
| Molecular formula | C13H11N3O4 |
|---|---|
| Molecular weight | 276.26 g/mol |
| IUPAC name | 4-amino-5,6,7-trideuterio-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| InChIKey | UVSMNLNDYGZFPF-CBYSEHNBSA-N |
| SMILES | [2H]C1=C(C2=C(C(=C1[2H])N)C(=O)N(C2=O)C3CCC(=O)NC3=O)[2H] |
Computed by PubChem (NCBI)