CAS 1378314-08-9 is the registry number for Ixazomib Impurity A. Offered by: Chemat Brand. Available pack sizes: on request.
N-(2-amino-2-oxoethyl)-2,5-dichlorobenzamide (CAS 1378314-08-9) is a chemical compound with the molecular formula C9H8Cl2N2O2 and a molecular weight of 247.07 g/mol. IUPAC name: N-(2-amino-2-oxoethyl)-2,5-dichlorobenzamide. InChIKey: QAWIEOUFVGCSLJ-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2N2O2 |
|---|---|
| Molecular weight | 247.07 g/mol |
| IUPAC name | N-(2-amino-2-oxoethyl)-2,5-dichlorobenzamide |
| InChIKey | QAWIEOUFVGCSLJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(=O)NCC(=O)N)Cl |
Computed by PubChem (NCBI)