CAS 62465-90-1 is the registry number for Methyl chloro[(4-chlorophenyl)hydrazono]acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
Methyl (2Z)-2-chloro-2-[(4-chlorophenyl)hydrazinylidene]acetate (CAS 62465-90-1) is a chemical compound with the molecular formula C9H8Cl2N2O2 and a molecular weight of 247.07 g/mol. IUPAC name: methyl (2Z)-2-chloro-2-[(4-chlorophenyl)hydrazinylidene]acetate. InChIKey: WFLLLIXHIJPUCA-JYRVWZFOSA-N.
| Molecular formula | C9H8Cl2N2O2 |
|---|---|
| Molecular weight | 247.07 g/mol |
| IUPAC name | methyl (2Z)-2-chloro-2-[(4-chlorophenyl)hydrazinylidene]acetate |
| InChIKey | WFLLLIXHIJPUCA-JYRVWZFOSA-N |
| SMILES | COC(=O)/C(=N/NC1=CC=C(C=C1)Cl)/Cl |
Computed by PubChem (NCBI)