CAS 356101-82-1 is the registry number for Methyl 2-[(e)-(2,3-dichlorophenyl)methylidene]-1-hydrazinecarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Methyl N-[(E)-(2,3-dichlorophenyl)methylideneamino]carbamate (CAS 356101-82-1) is a chemical compound with the molecular formula C9H8Cl2N2O2 and a molecular weight of 247.07 g/mol. IUPAC name: methyl N-[(E)-(2,3-dichlorophenyl)methylideneamino]carbamate. InChIKey: VCHSODXIKSNGGR-LFYBBSHMSA-N.
| Molecular formula | C9H8Cl2N2O2 |
|---|---|
| Molecular weight | 247.07 g/mol |
| IUPAC name | methyl N-[(E)-(2,3-dichlorophenyl)methylideneamino]carbamate |
| InChIKey | VCHSODXIKSNGGR-LFYBBSHMSA-N |
| SMILES | COC(=O)N/N=C/C1=C(C(=CC=C1)Cl)Cl |
Computed by PubChem (NCBI)