CAS 2734847-21-1 is the registry number for Methyl 1,4-dichloro-6,7-dihydro-5H-cyclopenta[d]pyridazine-5-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 1,4-dichloro-6,7-dihydro-5H-cyclopenta[d]pyridazine-5-carboxylate (CAS 2734847-21-1) is a chemical compound with the molecular formula C9H8Cl2N2O2 and a molecular weight of 247.07 g/mol. IUPAC name: methyl 1,4-dichloro-6,7-dihydro-5H-cyclopenta[d]pyridazine-5-carboxylate. InChIKey: YOBJYEAKJKROCO-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2N2O2 |
|---|---|
| Molecular weight | 247.07 g/mol |
| IUPAC name | methyl 1,4-dichloro-6,7-dihydro-5H-cyclopenta[d]pyridazine-5-carboxylate |
| InChIKey | YOBJYEAKJKROCO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CCC2=C1C(=NN=C2Cl)Cl |
Computed by PubChem (NCBI)