CAS 160152-04-5 is the registry number for N'-(2,2-Dichloroacetyl)benzohydrazide. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
N'-(2,2-dichloroacetyl)benzohydrazide (CAS 160152-04-5) is a chemical compound with the molecular formula C9H8Cl2N2O2 and a molecular weight of 247.07 g/mol. IUPAC name: N'-(2,2-dichloroacetyl)benzohydrazide. InChIKey: DOOTWISQOYOCKS-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2N2O2 |
|---|---|
| Molecular weight | 247.07 g/mol |
| IUPAC name | N'-(2,2-dichloroacetyl)benzohydrazide |
| InChIKey | DOOTWISQOYOCKS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NNC(=O)C(Cl)Cl |
Computed by PubChem (NCBI)