Products 2172461-21-9

CAS 2172461-21-9 is the registry number for Methyl 2-chloro-1H-1,3-benzodiazole-6-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 2,5g.

Structural formula: {0} (CAS {1})

Methyl 2-chloro-3H-benzimidazole-5-carboxylate;hydrochloride (CAS 2172461-21-9) is a chemical compound with the molecular formula C9H8Cl2N2O2 and a molecular weight of 247.07 g/mol. IUPAC name: methyl 2-chloro-3H-benzimidazole-5-carboxylate;hydrochloride. InChIKey: MKPGDGFAJCNDSB-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8Cl2N2O2
Molecular weight247.07 g/mol
IUPAC namemethyl 2-chloro-3H-benzimidazole-5-carboxylate;hydrochloride
InChIKeyMKPGDGFAJCNDSB-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC2=C(C=C1)N=C(N2)Cl.Cl

Computed by PubChem (NCBI)