Products 78622-22-7
CAS 78622-22-7 appears in our catalog under these names: N-carbamoyl-2-(2,6-dichlorophenyl)acetamide, Guanfacine Impurity 4, Guanfacine Impurity 6. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
N-carbamoyl-2-(2,6-dichlorophenyl)acetamide (CAS 78622-22-7) is a chemical compound with the molecular formula C9H8Cl2N2O2 and a molecular weight of 247.07 g/mol. IUPAC name: N-carbamoyl-2-(2,6-dichlorophenyl)acetamide. InChIKey: HVLKJZYZUOKDNZ-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2N2O2 |
|---|---|
| Molecular weight | 247.07 g/mol |
| IUPAC name | N-carbamoyl-2-(2,6-dichlorophenyl)acetamide |
| InChIKey | HVLKJZYZUOKDNZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)CC(=O)NC(=O)N)Cl |
Computed by PubChem (NCBI)