Products 90348-45-1
CAS 90348-45-1 is the registry number for 2,4-Dichloro-3-nitro-5,6,7,8-tetrahydroquinoline, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-dichloro-3-nitro-5,6,7,8-tetrahydroquinoline (CAS 90348-45-1) is a chemical compound with the molecular formula C9H8Cl2N2O2 and a molecular weight of 247.07 g/mol. IUPAC name: 2,4-dichloro-3-nitro-5,6,7,8-tetrahydroquinoline. InChIKey: IHPCVVSDFZVBPF-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2N2O2 |
|---|---|
| Molecular weight | 247.07 g/mol |
| IUPAC name | 2,4-dichloro-3-nitro-5,6,7,8-tetrahydroquinoline |
| InChIKey | IHPCVVSDFZVBPF-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C(=C(C(=N2)Cl)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)