Products 1379365-85-1

CAS 1379365-85-1 is the registry number for Methyl 2-bromo-3-nitropyridine-4-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 2-bromo-3-nitropyridine-4-carboxylate (CAS 1379365-85-1) is a chemical compound with the molecular formula C7H5BrN2O4 and a molecular weight of 261.03 g/mol. IUPAC name: methyl 2-bromo-3-nitropyridine-4-carboxylate. InChIKey: QRJJWDZQRDIOSE-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5BrN2O4
Molecular weight261.03 g/mol
IUPAC namemethyl 2-bromo-3-nitropyridine-4-carboxylate
InChIKeyQRJJWDZQRDIOSE-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C(=NC=C1)Br)[N+](=O)[O-]

Computed by PubChem (NCBI)