Products 138326-61-1

CAS 138326-61-1 is the registry number for Methyl 3-methyl-2-(methylamino)butanoate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 3-methyl-2-(methylamino)butanoate;hydrochloride (CAS 138326-61-1) is a chemical compound with the molecular formula C7H16ClNO2 and a molecular weight of 181.66 g/mol. IUPAC name: methyl 3-methyl-2-(methylamino)butanoate;hydrochloride. InChIKey: DLLHGHUMLSLOID-UHFFFAOYSA-N.

Identity
Molecular formulaC7H16ClNO2
Molecular weight181.66 g/mol
IUPAC namemethyl 3-methyl-2-(methylamino)butanoate;hydrochloride
InChIKeyDLLHGHUMLSLOID-UHFFFAOYSA-N
SMILESCC(C)C(C(=O)OC)NC.Cl

Computed by PubChem (NCBI)