Products 1391480-34-4
CAS 1391480-34-4 is the registry number for (S)-4-Amino-4-(4-chlorophenyl)butanoic acid hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(4S)-4-amino-4-(4-chlorophenyl)butanoic acid;hydrochloride (CAS 1391480-34-4) is a chemical compound with the molecular formula C10H13Cl2NO2 and a molecular weight of 250.12 g/mol. IUPAC name: (4S)-4-amino-4-(4-chlorophenyl)butanoic acid;hydrochloride. InChIKey: VAVMRHNTRLPBHU-FVGYRXGTSA-N.
| Molecular formula | C10H13Cl2NO2 |
|---|---|
| Molecular weight | 250.12 g/mol |
| IUPAC name | (4S)-4-amino-4-(4-chlorophenyl)butanoic acid;hydrochloride |
| InChIKey | VAVMRHNTRLPBHU-FVGYRXGTSA-N |
| SMILES | C1=CC(=CC=C1[C@H](CCC(=O)O)N)Cl.Cl |
Computed by PubChem (NCBI)