CAS 1391487-05-0 is the registry number for (R)–2–Amino–2–(2,5–dichlorophenyl)ethanol hydrochloride. Offered by: GLPBio. Available pack sizes: 100mg.
(2R)-2-amino-2-(2,5-dichlorophenyl)ethanol;hydrochloride (CAS 1391487-05-0) is a chemical compound with the molecular formula C8H10Cl3NO and a molecular weight of 242.5 g/mol. IUPAC name: (2R)-2-amino-2-(2,5-dichlorophenyl)ethanol;hydrochloride. InChIKey: FYGNQNNTBLYRHC-QRPNPIFTSA-N.
| Molecular formula | C8H10Cl3NO |
|---|---|
| Molecular weight | 242.5 g/mol |
| IUPAC name | (2R)-2-amino-2-(2,5-dichlorophenyl)ethanol;hydrochloride |
| InChIKey | FYGNQNNTBLYRHC-QRPNPIFTSA-N |
| SMILES | C1=CC(=C(C=C1Cl)[C@H](CO)N)Cl.Cl |
Computed by PubChem (NCBI)