Products 1391581-54-6
CAS 1391581-54-6 appears in our catalog under these names: Bis(4-methoxyphenyl)chlorophosphine, 95%, 95%, (S)-3-Amino-3-(3-bromophenyl)propanoic acid hydrochloride, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(3S)-3-amino-3-(3-bromophenyl)propanoic acid;hydrochloride (CAS 1391581-54-6) is a chemical compound with the molecular formula C9H11BrClNO2 and a molecular weight of 280.54 g/mol. IUPAC name: (3S)-3-amino-3-(3-bromophenyl)propanoic acid;hydrochloride. InChIKey: FCCKGEWWONHCDY-QRPNPIFTSA-N.
| Molecular formula | C9H11BrClNO2 |
|---|---|
| Molecular weight | 280.54 g/mol |
| IUPAC name | (3S)-3-amino-3-(3-bromophenyl)propanoic acid;hydrochloride |
| InChIKey | FCCKGEWWONHCDY-QRPNPIFTSA-N |
| SMILES | C1=CC(=CC(=C1)Br)[C@H](CC(=O)O)N.Cl |
Computed by PubChem (NCBI)