Products 1393531-96-8
CAS 1393531-96-8 appears in our catalog under these names: 3-(3-Chlorophenyl)oxetane-3-carboxylic acid, 95%, 3-(3-Chlorophenyl)oxetane-3-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, Chemat, Ambeed. Available pack sizes: 250mg, 1g, 100mg.
3-(3-chlorophenyl)oxetane-3-carboxylic acid (CAS 1393531-96-8) is a chemical compound with the molecular formula C10H9ClO3 and a molecular weight of 212.63 g/mol. IUPAC name: 3-(3-chlorophenyl)oxetane-3-carboxylic acid. InChIKey: CSSWOQPCIFLTMZ-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO3 |
|---|---|
| Molecular weight | 212.63 g/mol |
| IUPAC name | 3-(3-chlorophenyl)oxetane-3-carboxylic acid |
| InChIKey | CSSWOQPCIFLTMZ-UHFFFAOYSA-N |
| SMILES | C1C(CO1)(C2=CC(=CC=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)