CAS 1401539-30-7 is the registry number for Diethyl 2-(2-amino-3-nitropyridin-4-yl)malonate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
Diethyl 2-(2-amino-3-nitro-4-pyridinyl)propanedioate (CAS 1401539-30-7) is a chemical compound with the molecular formula C12H15N3O6 and a molecular weight of 297.26 g/mol. IUPAC name: diethyl 2-(2-amino-3-nitro-4-pyridinyl)propanedioate. InChIKey: HZUUOYSLDGAJEN-UHFFFAOYSA-N.
| Molecular formula | C12H15N3O6 |
|---|---|
| Molecular weight | 297.26 g/mol |
| IUPAC name | diethyl 2-(2-amino-3-nitro-4-pyridinyl)propanedioate |
| InChIKey | HZUUOYSLDGAJEN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=C(C(=NC=C1)N)[N+](=O)[O-])C(=O)OCC |
Computed by PubChem (NCBI)