CAS 1588441-20-6 is the registry number for tert–Butyl (2–methyl–3,5–dinitrophenyl)carbamate. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
Tert-butyl N-(2-methyl-3,5-dinitrophenyl)carbamate (CAS 1588441-20-6) is a chemical compound with the molecular formula C12H15N3O6 and a molecular weight of 297.26 g/mol. IUPAC name: tert-butyl N-(2-methyl-3,5-dinitrophenyl)carbamate. InChIKey: YNDRBUAYGVFYTM-UHFFFAOYSA-N.
| Molecular formula | C12H15N3O6 |
|---|---|
| Molecular weight | 297.26 g/mol |
| IUPAC name | tert-butyl N-(2-methyl-3,5-dinitrophenyl)carbamate |
| InChIKey | YNDRBUAYGVFYTM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1[N+](=O)[O-])[N+](=O)[O-])NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)