CAS 240408-81-5 appears in our catalog under these names: (S,S,S)-Triglycidyl isocyanurate, 95%, (S,S,S)–Triglycidyl Isocyanurate, (S,S,S)-Triglycidyl Isocyanurate, >98.0%(HPLC), (S,S,S)-Triglycidyl Isocyanurate. Offered by: Combi-blocks, GLPBio, TCI, Chemat. Available pack sizes: 250mg, 1g.
1,3,5-tris[[(2S)-oxiran-2-yl]methyl]-1,3,5-triazinane-2,4,6-trione (CAS 240408-81-5) is a chemical compound with the molecular formula C12H15N3O6 and a molecular weight of 297.26 g/mol. IUPAC name: 1,3,5-tris[[(2S)-oxiran-2-yl]methyl]-1,3,5-triazinane-2,4,6-trione. InChIKey: OUPZKGBUJRBPGC-CIUDSAMLSA-N.
| Molecular formula | C12H15N3O6 |
|---|---|
| Molecular weight | 297.26 g/mol |
| IUPAC name | 1,3,5-tris[[(2S)-oxiran-2-yl]methyl]-1,3,5-triazinane-2,4,6-trione |
| InChIKey | OUPZKGBUJRBPGC-CIUDSAMLSA-N |
| SMILES | C1[C@@H](O1)CN2C(=O)N(C(=O)N(C2=O)C[C@H]3CO3)C[C@H]4CO4 |
Computed by PubChem (NCBI)