CAS 1638385-00-8 appears in our catalog under these names: 1,3,5-Tris(((2S)-oxiran-2-yl)methyl)-1,3,5-triazinane-2,4,6-trione, 95%, 1,3,5-TRIS[[(2S)-OXIRAN-2-YL]METHYL]-1,3,5-TRIAZINANE-2,4,6-TRIONE, ≥98%(N). Offered by: AmBeed, Fluorochem. Available pack sizes: 5g, 1g.
2,4,6-tris[[(2S)-oxiran-2-yl]methoxy]-1,3,5-triazine (CAS 1638385-00-8) is a chemical compound with the molecular formula C12H15N3O6 and a molecular weight of 297.26 g/mol. IUPAC name: 2,4,6-tris[[(2S)-oxiran-2-yl]methoxy]-1,3,5-triazine. InChIKey: BLPURQSRCDKZNX-CIUDSAMLSA-N.
| Molecular formula | C12H15N3O6 |
|---|---|
| Molecular weight | 297.26 g/mol |
| IUPAC name | 2,4,6-tris[[(2S)-oxiran-2-yl]methoxy]-1,3,5-triazine |
| InChIKey | BLPURQSRCDKZNX-CIUDSAMLSA-N |
| SMILES | C1[C@H](O1)COC2=NC(=NC(=N2)OC[C@@H]3CO3)OC[C@@H]4CO4 |
Computed by PubChem (NCBI)