Products 59653-73-5
CAS 59653-73-5 appears in our catalog under these names: alpha-Triglycidyl Isocyanurate, α-Triglycidyl isocyanurate. Offered by: TRC, MedChemExpress. Available pack sizes: 1g, Get quote.
1,5-bis[[(2R)-oxiran-2-yl]methyl]-3-[[(2S)-oxiran-2-yl]methyl]-1,3,5-triazinane-2,4,6-trione (CAS 59653-73-5) is a chemical compound with the molecular formula C12H15N3O6 and a molecular weight of 297.26 g/mol. IUPAC name: 1,5-bis[[(2R)-oxiran-2-yl]methyl]-3-[[(2S)-oxiran-2-yl]methyl]-1,3,5-triazinane-2,4,6-trione. InChIKey: OUPZKGBUJRBPGC-HLTSFMKQSA-N.
| Molecular formula | C12H15N3O6 |
|---|---|
| Molecular weight | 297.26 g/mol |
| IUPAC name | 1,5-bis[[(2R)-oxiran-2-yl]methyl]-3-[[(2S)-oxiran-2-yl]methyl]-1,3,5-triazinane-2,4,6-trione |
| InChIKey | OUPZKGBUJRBPGC-HLTSFMKQSA-N |
| SMILES | C1[C@@H](O1)CN2C(=O)N(C(=O)N(C2=O)C[C@@H]3CO3)C[C@@H]4CO4 |
Computed by PubChem (NCBI)