Products 240408-78-0

CAS 240408-78-0 appears in our catalog under these names: Isocyanuric acid (r,r,r)-triglycidyl ester, 95%, (R,R,R)–Triglycidyl Isocyanurate, (R,R,R)-Triglycidyl Isocyanurate, >95.0%(HPLC), Isocyanuric acid (r,r,r)-triglycidyl ester, ≥95%(HPLC), ≥95%(HPLC). Offered by: Combi-blocks, GLPBio, TCI, Chemat. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

1,3,5-tris[[(2R)-oxiran-2-yl]methyl]-1,3,5-triazinane-2,4,6-trione (CAS 240408-78-0) is a chemical compound with the molecular formula C12H15N3O6 and a molecular weight of 297.26 g/mol. IUPAC name: 1,3,5-tris[[(2R)-oxiran-2-yl]methyl]-1,3,5-triazinane-2,4,6-trione. InChIKey: OUPZKGBUJRBPGC-IWSPIJDZSA-N.

Identity
Molecular formulaC12H15N3O6
Molecular weight297.26 g/mol
IUPAC name1,3,5-tris[[(2R)-oxiran-2-yl]methyl]-1,3,5-triazinane-2,4,6-trione
InChIKeyOUPZKGBUJRBPGC-IWSPIJDZSA-N
SMILESC1[C@H](O1)CN2C(=O)N(C(=O)N(C2=O)C[C@@H]3CO3)C[C@@H]4CO4

Computed by PubChem (NCBI)