CAS 1638385-03-1 is the registry number for 1,3,5-Tris(((R)-oxiran-2-yl)methyl)-1,3,5-triazinane-2,4,6-trione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,3,5-tris[[(2R)-oxiran-2-yl]methyl]-1,3,5-triazinane-2,4,6-trione (CAS 1638385-03-1) is a chemical compound with the molecular formula C12H15N3O6 and a molecular weight of 297.26 g/mol. IUPAC name: 1,3,5-tris[[(2R)-oxiran-2-yl]methyl]-1,3,5-triazinane-2,4,6-trione. InChIKey: OUPZKGBUJRBPGC-IWSPIJDZSA-N.
| Molecular formula | C12H15N3O6 |
|---|---|
| Molecular weight | 297.26 g/mol |
| IUPAC name | 1,3,5-tris[[(2R)-oxiran-2-yl]methyl]-1,3,5-triazinane-2,4,6-trione |
| InChIKey | OUPZKGBUJRBPGC-IWSPIJDZSA-N |
| SMILES | C1[C@H](O1)CN2C(=O)N(C(=O)N(C2=O)C[C@@H]3CO3)C[C@@H]4CO4 |
Computed by PubChem (NCBI)