CAS 898-22-6 appears in our catalog under these names: Triethyl 1,3,5-triazine-2,4,6-tricarboxylate, 97%, Triethyl 1,3,5-triazine-2,4,6-tricarboxylate, Triethyl 1,3,5-triazine-2,4,6-tricarboxylate 98%, TRIETHYL 1,3,5-TRIAZINE-2,4,6-TRICARBOX&, Triethyl 1,3,5-triazine-2,4,6-tricarboxylate, 98%, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 1g, 5g, 2,5g, 100mg, 250mg.
Triethyl 1,3,5-triazine-2,4,6-tricarboxylate (CAS 898-22-6) is a chemical compound with the molecular formula C12H15N3O6 and a molecular weight of 297.26 g/mol. IUPAC name: triethyl 1,3,5-triazine-2,4,6-tricarboxylate. InChIKey: LKNPNZKIOSOWES-UHFFFAOYSA-N.
| Molecular formula | C12H15N3O6 |
|---|---|
| Molecular weight | 297.26 g/mol |
| IUPAC name | triethyl 1,3,5-triazine-2,4,6-tricarboxylate |
| InChIKey | LKNPNZKIOSOWES-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC(=NC(=N1)C(=O)OCC)C(=O)OCC |
Computed by PubChem (NCBI)