Products 1401662-77-8
CAS 1401662-77-8 appears in our catalog under these names: N–(((9H–Fluoren–9–yl)methoxy)carbonyl)–O–phenyl–L–serine, Fmoc-L-Ser(Ph)-OH, Fmoc-Ser(O-Phenyl)-OH 98%, N-(((9H-Fluoren-9-yl)methoxy)carbonyl)-O-phenyl-L-serine, 98%, 98%, Fmoc-Ser(O-Phenyl)-OH, 98%. Offered by: GLPBio, Iris Biotech, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenoxypropanoic acid (CAS 1401662-77-8) is a chemical compound with the molecular formula C24H21NO5 and a molecular weight of 403.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenoxypropanoic acid. InChIKey: HGQDEAAPBMSFJT-QFIPXVFZSA-N.
| Molecular formula | C24H21NO5 |
|---|---|
| Molecular weight | 403.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenoxypropanoic acid |
| InChIKey | HGQDEAAPBMSFJT-QFIPXVFZSA-N |
| SMILES | C1=CC=C(C=C1)OC[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)