Products 1405433-68-2
CAS 1405433-68-2 is the registry number for N-(3-Bromothiophene-2-carbonyl)-N-(cyclopropylmethyl)glycine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(3-bromothiophene-2-carbonyl)-(cyclopropylmethyl)amino]acetic acid (CAS 1405433-68-2) is a chemical compound with the molecular formula C11H12BrNO3S and a molecular weight of 318.19 g/mol. IUPAC name: 2-[(3-bromothiophene-2-carbonyl)-(cyclopropylmethyl)amino]acetic acid. InChIKey: MQJABGQEBICOAF-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNO3S |
|---|---|
| Molecular weight | 318.19 g/mol |
| IUPAC name | 2-[(3-bromothiophene-2-carbonyl)-(cyclopropylmethyl)amino]acetic acid |
| InChIKey | MQJABGQEBICOAF-UHFFFAOYSA-N |
| SMILES | C1CC1CN(CC(=O)O)C(=O)C2=C(C=CS2)Br |
Computed by PubChem (NCBI)