CAS 929000-54-4 is the registry number for 1–((4–Bromophenyl)sulfonyl)piperidin–4–one. Offered by: GLPBio. Available pack sizes: 1g.
1-(4-bromophenyl)sulfonylpiperidin-4-one (CAS 929000-54-4) is a chemical compound with the molecular formula C11H12BrNO3S and a molecular weight of 318.19 g/mol. IUPAC name: 1-(4-bromophenyl)sulfonylpiperidin-4-one. InChIKey: CVRKCAXMZOAGQZ-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNO3S |
|---|---|
| Molecular weight | 318.19 g/mol |
| IUPAC name | 1-(4-bromophenyl)sulfonylpiperidin-4-one |
| InChIKey | CVRKCAXMZOAGQZ-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1=O)S(=O)(=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)