CAS 303016-10-6 is the registry number for 2-Bromo-N-(1,1-dioxidotetrahydrothiophen-3-yl)benzamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-N-(1,1-dioxothiolan-3-yl)benzamide (CAS 303016-10-6) is a chemical compound with the molecular formula C11H12BrNO3S and a molecular weight of 318.19 g/mol. IUPAC name: 2-bromo-N-(1,1-dioxothiolan-3-yl)benzamide. InChIKey: KIVHOUOKFPDDBN-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNO3S |
|---|---|
| Molecular weight | 318.19 g/mol |
| IUPAC name | 2-bromo-N-(1,1-dioxothiolan-3-yl)benzamide |
| InChIKey | KIVHOUOKFPDDBN-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC1NC(=O)C2=CC=CC=C2Br |
Computed by PubChem (NCBI)