CAS 170456-82-3 appears in our catalog under these names: 4-Bromo-1-tosylpyrrolidin-3-one, 4-Bromo-1-tosylpyrrolidin-3-one, 95%. Offered by: TRC, Combi-blocks. Available pack sizes: 500mg, 250mg, 1g, 100mg.
4-bromo-1-(4-methylphenyl)sulfonylpyrrolidin-3-one (CAS 170456-82-3) is a chemical compound with the molecular formula C11H12BrNO3S and a molecular weight of 318.19 g/mol. IUPAC name: 4-bromo-1-(4-methylphenyl)sulfonylpyrrolidin-3-one. InChIKey: GZHSUXXRBWNDMF-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNO3S |
|---|---|
| Molecular weight | 318.19 g/mol |
| IUPAC name | 4-bromo-1-(4-methylphenyl)sulfonylpyrrolidin-3-one |
| InChIKey | GZHSUXXRBWNDMF-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CC(C(=O)C2)Br |
Computed by PubChem (NCBI)