Products 1456977-99-3
CAS 1456977-99-3 is the registry number for 1-(3-Bromothiophene-2-carbonyl)piperidine-4-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(3-bromothiophene-2-carbonyl)piperidine-4-carboxylic acid (CAS 1456977-99-3) is a chemical compound with the molecular formula C11H12BrNO3S and a molecular weight of 318.19 g/mol. IUPAC name: 1-(3-bromothiophene-2-carbonyl)piperidine-4-carboxylic acid. InChIKey: HZFCQQMZOHRROO-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNO3S |
|---|---|
| Molecular weight | 318.19 g/mol |
| IUPAC name | 1-(3-bromothiophene-2-carbonyl)piperidine-4-carboxylic acid |
| InChIKey | HZFCQQMZOHRROO-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C(=O)O)C(=O)C2=C(C=CS2)Br |
Computed by PubChem (NCBI)