CAS 919466-75-4 is the registry number for 2-({((4-Bromophenyl)carbamoyl)methyl}sulfanyl)propanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-[2-(4-bromoanilino)-2-oxoethyl]sulfanylpropanoic acid (CAS 919466-75-4) is a chemical compound with the molecular formula C11H12BrNO3S and a molecular weight of 318.19 g/mol. IUPAC name: 2-[2-(4-bromoanilino)-2-oxoethyl]sulfanylpropanoic acid. InChIKey: CBJPEGRDIKVMIO-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNO3S |
|---|---|
| Molecular weight | 318.19 g/mol |
| IUPAC name | 2-[2-(4-bromoanilino)-2-oxoethyl]sulfanylpropanoic acid |
| InChIKey | CBJPEGRDIKVMIO-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)SCC(=O)NC1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)