Products 919466-75-4

CAS 919466-75-4 is the registry number for 2-({((4-Bromophenyl)carbamoyl)methyl}sulfanyl)propanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-[2-(4-bromoanilino)-2-oxoethyl]sulfanylpropanoic acid (CAS 919466-75-4) is a chemical compound with the molecular formula C11H12BrNO3S and a molecular weight of 318.19 g/mol. IUPAC name: 2-[2-(4-bromoanilino)-2-oxoethyl]sulfanylpropanoic acid. InChIKey: CBJPEGRDIKVMIO-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12BrNO3S
Molecular weight318.19 g/mol
IUPAC name2-[2-(4-bromoanilino)-2-oxoethyl]sulfanylpropanoic acid
InChIKeyCBJPEGRDIKVMIO-UHFFFAOYSA-N
SMILESCC(C(=O)O)SCC(=O)NC1=CC=C(C=C1)Br

Computed by PubChem (NCBI)