Products 867333-26-4
CAS 867333-26-4 is the registry number for (4-​Bromophenyl)​(1,​1-​dioxido-​4-​thiomorpholinyl)​-methanone. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(4-bromophenyl)-(1,1-dioxo-1,4-thiazinan-4-yl)methanone (CAS 867333-26-4) is a chemical compound with the molecular formula C11H12BrNO3S and a molecular weight of 318.19 g/mol. IUPAC name: (4-bromophenyl)-(1,1-dioxo-1,4-thiazinan-4-yl)methanone. InChIKey: JZVOMFPVZJBLRG-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNO3S |
|---|---|
| Molecular weight | 318.19 g/mol |
| IUPAC name | (4-bromophenyl)-(1,1-dioxo-1,4-thiazinan-4-yl)methanone |
| InChIKey | JZVOMFPVZJBLRG-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCN1C(=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)