CAS 2222512-01-6 appears in our catalog under these names: 1-{3-[(4-Bromobenzene)sulfonyl]azetidin-1-yl}ethanone, 95%, 1-{3-((4-Bromobenzene)sulfonyl)azetidin-1-yl}ethanone, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 100mg.
1-[3-(4-bromophenyl)sulfonylazetidin-1-yl]ethanone (CAS 2222512-01-6) is a chemical compound with the molecular formula C11H12BrNO3S and a molecular weight of 318.19 g/mol. IUPAC name: 1-[3-(4-bromophenyl)sulfonylazetidin-1-yl]ethanone. InChIKey: ICLCJFCKBSMPKP-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNO3S |
|---|---|
| Molecular weight | 318.19 g/mol |
| IUPAC name | 1-[3-(4-bromophenyl)sulfonylazetidin-1-yl]ethanone |
| InChIKey | ICLCJFCKBSMPKP-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CC(C1)S(=O)(=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)