CAS 27295-64-3 is the registry number for 4-Methyl-2,3-dihydro-1h-pyrrolo[3,4-c]quinoline-1,3-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-methylpyrrolo[3,4-c]quinoline-1,3-dione (CAS 27295-64-3) is a chemical compound with the molecular formula C12H8N2O2 and a molecular weight of 212.20 g/mol. IUPAC name: 4-methylpyrrolo[3,4-c]quinoline-1,3-dione. InChIKey: RDOYVWRCQYHNHO-UHFFFAOYSA-N.
| Molecular formula | C12H8N2O2 |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | 4-methylpyrrolo[3,4-c]quinoline-1,3-dione |
| InChIKey | RDOYVWRCQYHNHO-UHFFFAOYSA-N |
| SMILES | CC1=NC2=CC=CC=C2C3=C1C(=O)NC3=O |
Computed by PubChem (NCBI)