CAS 141342-70-3 appears in our catalog under these names: Dehydro Epinastine (Impurity A) HCl, Epinastine Impurity 1(Epinastine EP Impurity A), 9H-Dibenzo[c,f]imidazo[1,5-a]azepin-3-amine hydrochloride, 95%, 95%. Offered by: Chemat Brand, Hubei YoungXin, Chemat. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2,4-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),3,5,7,9,11,14,16-octaen-3-amine;hydrochloride (CAS 141342-70-3) is a chemical compound with the molecular formula C16H14ClN3 and a molecular weight of 283.75 g/mol. IUPAC name: 2,4-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),3,5,7,9,11,14,16-octaen-3-amine;hydrochloride. InChIKey: ORYLHPLXKXXXKR-UHFFFAOYSA-N.
| Molecular formula | C16H14ClN3 |
|---|---|
| Molecular weight | 283.75 g/mol |
| IUPAC name | 2,4-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),3,5,7,9,11,14,16-octaen-3-amine;hydrochloride |
| InChIKey | ORYLHPLXKXXXKR-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C3=CN=C(N3C4=CC=CC=C41)N.Cl |
Computed by PubChem (NCBI)