CAS 889939-52-0 is the registry number for 8-Chloro-2-m-tolyl-6,7-dihydro-5H-cyclopenta[d]-pyrazolo[1,5-a]pyrimidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-11-(3-methylphenyl)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene (CAS 889939-52-0) is a chemical compound with the molecular formula C16H14ClN3 and a molecular weight of 283.75 g/mol. IUPAC name: 2-chloro-11-(3-methylphenyl)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene. InChIKey: LOEVTARPTCCVCY-UHFFFAOYSA-N.
| Molecular formula | C16H14ClN3 |
|---|---|
| Molecular weight | 283.75 g/mol |
| IUPAC name | 2-chloro-11-(3-methylphenyl)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene |
| InChIKey | LOEVTARPTCCVCY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2=NN3C(=C2)N=C4CCCC4=C3Cl |
Computed by PubChem (NCBI)