Products 79916-53-3
CAS 79916-53-3 appears in our catalog under these names: 4–(4–Chloroquinazolin–2–yl)–N，N–dimethylaniline, 4-(4-Chloroquinazolin-2-yl)-N,N-dimethylaniline, 4-(4-Chloroquinazolin-2-yl)-N,N-dimethylaniline 97%, 4-(4-Chloro-2-quinazolinyl)-N,N-dimethylbenzenamine, 97%, 97%, 4-(4-CHLOROQUINAZOLIN-2-YL)-N,N-DIMETHYLANILINE, 97%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 0,5g, 250mg, 1g.
4-(4-chloroquinazolin-2-yl)-N,N-dimethylaniline (CAS 79916-53-3) is a chemical compound with the molecular formula C16H14ClN3 and a molecular weight of 283.75 g/mol. IUPAC name: 4-(4-chloroquinazolin-2-yl)-N,N-dimethylaniline. InChIKey: ZUWQMICNQFRGOU-UHFFFAOYSA-N.
| Molecular formula | C16H14ClN3 |
|---|---|
| Molecular weight | 283.75 g/mol |
| IUPAC name | 4-(4-chloroquinazolin-2-yl)-N,N-dimethylaniline |
| InChIKey | ZUWQMICNQFRGOU-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C2=NC3=CC=CC=C3C(=N2)Cl |
Computed by PubChem (NCBI)