CAS 83833-14-1 is the registry number for 4-(Phenylazo)-1-naphthalenamine hydrochloride, Dye content 85%, Dye content 85%. Offered by: Chemat. Available pack sizes: 5g.
4-phenyldiazenylnaphthalen-1-amine;hydrochloride (CAS 83833-14-1) is a chemical compound with the molecular formula C16H14ClN3 and a molecular weight of 283.75 g/mol. IUPAC name: 4-phenyldiazenylnaphthalen-1-amine;hydrochloride. InChIKey: CBIKBLARWHZKSA-UHFFFAOYSA-N.
| Molecular formula | C16H14ClN3 |
|---|---|
| Molecular weight | 283.75 g/mol |
| IUPAC name | 4-phenyldiazenylnaphthalen-1-amine;hydrochloride |
| InChIKey | CBIKBLARWHZKSA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N=NC2=CC=C(C3=CC=CC=C32)N.Cl |
Computed by PubChem (NCBI)