Products 83833-14-1

CAS 83833-14-1 is the registry number for 4-(Phenylazo)-1-naphthalenamine hydrochloride, Dye content 85%, Dye content 85%. Offered by: Chemat. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

4-phenyldiazenylnaphthalen-1-amine;hydrochloride (CAS 83833-14-1) is a chemical compound with the molecular formula C16H14ClN3 and a molecular weight of 283.75 g/mol. IUPAC name: 4-phenyldiazenylnaphthalen-1-amine;hydrochloride. InChIKey: CBIKBLARWHZKSA-UHFFFAOYSA-N.

Identity
Molecular formulaC16H14ClN3
Molecular weight283.75 g/mol
IUPAC name4-phenyldiazenylnaphthalen-1-amine;hydrochloride
InChIKeyCBIKBLARWHZKSA-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)N=NC2=CC=C(C3=CC=CC=C32)N.Cl

Computed by PubChem (NCBI)